C27H50O4Si2 — CID 11081542
(4R,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-8-phenylmethoxyoctanal (PubChem CID 11081542) has the molecular formula C27H50O4Si2 and a molecular weight of 494.87 g/mol. Its IUPAC name is (4R,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-8-phenylmethoxyoctanal.
| Compound Name | (4R,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-8-phenylmethoxyoctanal |
|---|---|
| PubChem CID | 11081542 |
| Molecular Formula | C27H50O4Si2 |
| Molecular Weight | 494.87 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | (4R,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-8-phenylmethoxyoctanal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CCC=O)[C@@H](CCCOCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O4Si2/c1-26(2,3)32(7,8)30-24(18-14-20-28)25(31-33(9,10)27(4,5)6)19-15-21-29-22-23-16-12-11-13-17-23/h11-13,16-17,20,24-25H,14-15,18-19,21-22H2,1-10H3/t24-,25-/m1/s1 |
| InChIKey | PUFQZZDQSQZOKP-JWQCQUIFSA-N |
| XLogP | 7.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.87 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|