C32H42O3Si — CID 11168008
(3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-8-phenylmethoxyoctanal (PubChem CID 11168008) has the molecular formula C32H42O3Si and a molecular weight of 502.77 g/mol. Its IUPAC name is (3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-8-phenylmethoxyoctanal.
| Compound Name | (3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-8-phenylmethoxyoctanal |
|---|---|
| PubChem CID | 11168008 |
| Molecular Formula | C32H42O3Si |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | (3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-8-phenylmethoxyoctanal |
| SMILES | C[C@H](CC=O)[C@@H](CCCCOCc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H42O3Si/c1-27(23-24-33)31(22-14-15-25-34-26-28-16-8-5-9-17-28)35-36(32(2,3)4,29-18-10-6-11-19-29)30-20-12-7-13-21-30/h5-13,16-21,24,27,31H,14-15,22-23,25-26H2,1-4H3/t27-,31-/m1/s1 |
| InChIKey | DLGFBHBTVAAZSB-DLFZDVPBSA-N |
| XLogP | 6.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|