C45H56O5Si — CID 101095816
[(4R,6S,7R)-6-[tert-butyl(diphenyl)silyl]oxy-7-methyl-1-phenylmethoxydec-9-en-4-yl] 2-methoxy-6-prop-2-enylbenzoate (PubChem CID 101095816) has the molecular formula C45H56O5Si and a molecular weight of 705.02 g/mol. Its IUPAC name is [(4R,6S,7R)-6-[tert-butyl(diphenyl)silyl]oxy-7-methyl-1-phenylmethoxydec-9-en-4-yl] 2-methoxy-6-prop-2-enylbenzoate.
| Compound Name | [(4R,6S,7R)-6-[tert-butyl(diphenyl)silyl]oxy-7-methyl-1-phenylmethoxydec-9-en-4-yl] 2-methoxy-6-prop-2-enylbenzoate |
|---|---|
| PubChem CID | 101095816 |
| Molecular Formula | C45H56O5Si |
| Molecular Weight | 705.02 g/mol |
| Exact Mass | 704.39 |
| IUPAC Name | [(4R,6S,7R)-6-[tert-butyl(diphenyl)silyl]oxy-7-methyl-1-phenylmethoxydec-9-en-4-yl] 2-methoxy-6-prop-2-enylbenzoate |
| SMILES | C=CCc1cccc(OC)c1C(=O)O[C@H](CCCOCc1ccccc1)C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)CC=C |
| InChI | InChI=1S/C45H56O5Si/c1-8-21-35(3)42(50-51(45(4,5)6,39-27-15-11-16-28-39)40-29-17-12-18-30-40)33-38(26-20-32-48-34-36-23-13-10-14-24-36)49-44(46)43-37(22-9-2)25-19-31-41(43)47-7/h8-19,23-25,27-31,35,38,42H,1-2,20-22,26,32-34H2,3-7H3/t35-,38-,42+/m1/s1 |
| InChIKey | SQWHDNAANQFLFB-HQUODVNOSA-N |
| XLogP | 9.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.02 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|