C30H44O5Si — CID 134938019
[(4R,6R,7R)-6-[tert-butyl(diphenyl)silyl]oxy-7,8-dihydroxyoctan-4-yl] hex-5-enoate (PubChem CID 134938019) has the molecular formula C30H44O5Si and a molecular weight of 512.76 g/mol. Its IUPAC name is [(4R,6R,7R)-6-[tert-butyl(diphenyl)silyl]oxy-7,8-dihydroxyoctan-4-yl] hex-5-enoate.
| Compound Name | [(4R,6R,7R)-6-[tert-butyl(diphenyl)silyl]oxy-7,8-dihydroxyoctan-4-yl] hex-5-enoate |
|---|---|
| PubChem CID | 134938019 |
| Molecular Formula | C30H44O5Si |
| Molecular Weight | 512.76 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | [(4R,6R,7R)-6-[tert-butyl(diphenyl)silyl]oxy-7,8-dihydroxyoctan-4-yl] hex-5-enoate |
| SMILES | C=CCCCC(=O)O[C@H](CCC)C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)CO |
| InChI | InChI=1S/C30H44O5Si/c1-6-8-11-21-29(33)34-24(16-7-2)22-28(27(32)23-31)35-36(30(3,4)5,25-17-12-9-13-18-25)26-19-14-10-15-20-26/h6,9-10,12-15,17-20,24,27-28,31-32H,1,7-8,11,16,21-23H2,2-5H3/t24-,27-,28-/m1/s1 |
| InChIKey | DIDLTSXHTGKNRG-RYRVMRHHSA-N |
| XLogP | 4.74 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.76 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|