C24H36O2Si — CID 58876341
(3R)-3-[tert-butyl(diphenyl)silyl]oxyoctan-2-ol (PubChem CID 58876341) has the molecular formula C24H36O2Si and a molecular weight of 384.64 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(diphenyl)silyl]oxyoctan-2-ol.
| Compound Name | (3R)-3-[tert-butyl(diphenyl)silyl]oxyoctan-2-ol |
|---|---|
| PubChem CID | 58876341 |
| Molecular Formula | C24H36O2Si |
| Molecular Weight | 384.64 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (3R)-3-[tert-butyl(diphenyl)silyl]oxyoctan-2-ol |
| SMILES | CCCCC[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)O |
| InChI | InChI=1S/C24H36O2Si/c1-6-7-10-19-23(20(2)25)26-27(24(3,4)5,21-15-11-8-12-16-21)22-17-13-9-14-18-22/h8-9,11-18,20,23,25H,6-7,10,19H2,1-5H3/t20?,23-/m1/s1 |
| InChIKey | CVLTYLDAXMAGGA-GWQXNCQPSA-N |
| XLogP | 4.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|