C31H50OSi — CID 11634122
tert-butyl-[(2S,6S)-2,6-dimethyltridecoxy]-diphenylsilane (PubChem CID 11634122) has the molecular formula C31H50OSi and a molecular weight of 466.83 g/mol. Its IUPAC name is tert-butyl-[(2S,6S)-2,6-dimethyltridecoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S,6S)-2,6-dimethyltridecoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11634122 |
| Molecular Formula | C31H50OSi |
| Molecular Weight | 466.83 g/mol |
| Exact Mass | 466.36 |
| IUPAC Name | tert-butyl-[(2S,6S)-2,6-dimethyltridecoxy]-diphenylsilane |
| SMILES | CCCCCCC[C@H](C)CCC[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H50OSi/c1-7-8-9-10-13-19-27(2)20-18-21-28(3)26-32-33(31(4,5)6,29-22-14-11-15-23-29)30-24-16-12-17-25-30/h11-12,14-17,22-25,27-28H,7-10,13,18-21,26H2,1-6H3/t27-,28-/m0/s1 |
| InChIKey | LRUDKFCAMQTWKY-NSOVKSMOSA-N |
| XLogP | 8.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.83 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|