C28H42O3Si — CID 10789919
[(2S,3S,7R)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloctan-2-yl] acetate (PubChem CID 10789919) has the molecular formula C28H42O3Si and a molecular weight of 454.73 g/mol. Its IUPAC name is [(2S,3S,7R)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloctan-2-yl] acetate.
| Compound Name | [(2S,3S,7R)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloctan-2-yl] acetate |
|---|---|
| PubChem CID | 10789919 |
| Molecular Formula | C28H42O3Si |
| Molecular Weight | 454.73 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | [(2S,3S,7R)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloctan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)[C@@H](C)CCC[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H42O3Si/c1-22(15-14-16-23(2)24(3)31-25(4)29)21-30-32(28(5,6)7,26-17-10-8-11-18-26)27-19-12-9-13-20-27/h8-13,17-20,22-24H,14-16,21H2,1-7H3/t22-,23+,24+/m1/s1 |
| InChIKey | GTDBOFMBJCCCFN-SGNDLWITSA-N |
| XLogP | 5.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.73 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|