C25H34O3Si — CID 69284121
(E,6S)-7-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethylhept-2-enoic acid (PubChem CID 69284121) has the molecular formula C25H34O3Si and a molecular weight of 410.63 g/mol. Its IUPAC name is (E,6S)-7-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethylhept-2-enoic acid.
| Compound Name | (E,6S)-7-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethylhept-2-enoic acid |
|---|---|
| PubChem CID | 69284121 |
| Molecular Formula | C25H34O3Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (E,6S)-7-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethylhept-2-enoic acid |
| SMILES | C/C(=C\CC[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C25H34O3Si/c1-20(13-12-14-21(2)24(26)27)19-28-29(25(3,4)5,22-15-8-6-9-16-22)23-17-10-7-11-18-23/h6-11,14-18,20H,12-13,19H2,1-5H3,(H,26,27)/b21-14+/t20-/m0/s1 |
| InChIKey | HLCKOELOXFUAIW-LQOIVRHRSA-N |
| XLogP | 5.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|