C27H38O2Si — CID 71608924
(E,6R,8R)-9-[tert-butyl(diphenyl)silyl]oxy-6,8-dimethylnon-3-en-2-one (PubChem CID 71608924) has the molecular formula C27H38O2Si and a molecular weight of 422.69 g/mol. Its IUPAC name is (E,6R,8R)-9-[tert-butyl(diphenyl)silyl]oxy-6,8-dimethylnon-3-en-2-one.
| Compound Name | (E,6R,8R)-9-[tert-butyl(diphenyl)silyl]oxy-6,8-dimethylnon-3-en-2-one |
|---|---|
| PubChem CID | 71608924 |
| Molecular Formula | C27H38O2Si |
| Molecular Weight | 422.69 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | (E,6R,8R)-9-[tert-butyl(diphenyl)silyl]oxy-6,8-dimethylnon-3-en-2-one |
| SMILES | CC(=O)/C=C/C[C@@H](C)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H38O2Si/c1-22(14-13-15-24(3)28)20-23(2)21-29-30(27(4,5)6,25-16-9-7-10-17-25)26-18-11-8-12-19-26/h7-13,15-19,22-23H,14,20-21H2,1-6H3/b15-13+/t22-,23-/m1/s1 |
| InChIKey | IZWFEWVEKMCKBQ-HOEBRKOCSA-N |
| XLogP | 5.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.69 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|