C35H54O4Si2 — CID 71480533
(E,6R)-10-[tert-butyl(diphenyl)silyl]oxy-6-tri(propan-2-yl)silyloxydec-3-ene-2,8-dione (PubChem CID 71480533) has the molecular formula C35H54O4Si2 and a molecular weight of 594.99 g/mol. Its IUPAC name is (E,6R)-10-[tert-butyl(diphenyl)silyl]oxy-6-tri(propan-2-yl)silyloxydec-3-ene-2,8-dione.
| Compound Name | (E,6R)-10-[tert-butyl(diphenyl)silyl]oxy-6-tri(propan-2-yl)silyloxydec-3-ene-2,8-dione |
|---|---|
| PubChem CID | 71480533 |
| Molecular Formula | C35H54O4Si2 |
| Molecular Weight | 594.99 g/mol |
| Exact Mass | 594.36 |
| IUPAC Name | (E,6R)-10-[tert-butyl(diphenyl)silyl]oxy-6-tri(propan-2-yl)silyloxydec-3-ene-2,8-dione |
| SMILES | CC(=O)/C=C/C[C@H](CC(=O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H54O4Si2/c1-27(2)40(28(3)4,29(5)6)39-32(19-17-18-30(7)36)26-31(37)24-25-38-41(35(8,9)10,33-20-13-11-14-21-33)34-22-15-12-16-23-34/h11-18,20-23,27-29,32H,19,24-26H2,1-10H3/b18-17+/t32-/m1/s1 |
| InChIKey | ZLBQOFUTZTZVBH-MKFZFTIWSA-N |
| XLogP | 8.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.99 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|