C24H32O3Si — CID 99772672
methyl (E)-6-[tert-butyl(diphenyl)silyl]oxy-3-methylhex-2-enoate (PubChem CID 99772672) has the molecular formula C24H32O3Si and a molecular weight of 396.60 g/mol. Its IUPAC name is methyl (E)-6-[tert-butyl(diphenyl)silyl]oxy-3-methylhex-2-enoate.
| Compound Name | methyl (E)-6-[tert-butyl(diphenyl)silyl]oxy-3-methylhex-2-enoate |
|---|---|
| PubChem CID | 99772672 |
| Molecular Formula | C24H32O3Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | methyl (E)-6-[tert-butyl(diphenyl)silyl]oxy-3-methylhex-2-enoate |
| SMILES | COC(=O)/C=C(\C)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H32O3Si/c1-20(19-23(25)26-5)13-12-18-27-28(24(2,3)4,21-14-8-6-9-15-21)22-16-10-7-11-17-22/h6-11,14-17,19H,12-13,18H2,1-5H3/b20-19+ |
| InChIKey | ODURTJJWIVSJMF-FMQUCBEESA-N |
| XLogP | 4.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|