C44H58O3Si2 — CID 102464729
(E)-1,12-bis[[tert-butyl(diphenyl)silyl]oxy]dodec-4-en-6-one (PubChem CID 102464729) has the molecular formula C44H58O3Si2 and a molecular weight of 691.12 g/mol. Its IUPAC name is (E)-1,12-bis[[tert-butyl(diphenyl)silyl]oxy]dodec-4-en-6-one.
| Compound Name | (E)-1,12-bis[[tert-butyl(diphenyl)silyl]oxy]dodec-4-en-6-one |
|---|---|
| PubChem CID | 102464729 |
| Molecular Formula | C44H58O3Si2 |
| Molecular Weight | 691.12 g/mol |
| Exact Mass | 690.39 |
| IUPAC Name | (E)-1,12-bis[[tert-butyl(diphenyl)silyl]oxy]dodec-4-en-6-one |
| SMILES | CC(C)(C)[Si](OCCC/C=C/C(=O)CCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H58O3Si2/c1-43(2,3)48(39-28-16-9-17-29-39,40-30-18-10-19-31-40)46-36-24-8-7-14-26-38(45)27-15-13-25-37-47-49(44(4,5)6,41-32-20-11-21-33-41)42-34-22-12-23-35-42/h9-12,15-23,27-35H,7-8,13-14,24-26,36-37H2,1-6H3/b27-15+ |
| InChIKey | MDQWSDBBIPOJJK-JFLMPSFJSA-N |
| XLogP | 9.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.12 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|