C22H29ClOSi — CID 71404440
tert-butyl-(6-chlorohex-4-enoxy)-diphenylsilane (PubChem CID 71404440) has the molecular formula C22H29ClOSi and a molecular weight of 373.01 g/mol. Its IUPAC name is tert-butyl-(6-chlorohex-4-enoxy)-diphenylsilane.
| Compound Name | tert-butyl-(6-chlorohex-4-enoxy)-diphenylsilane |
|---|---|
| PubChem CID | 71404440 |
| Molecular Formula | C22H29ClOSi |
| Molecular Weight | 373.01 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | tert-butyl-(6-chlorohex-4-enoxy)-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCC=CCCl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29ClOSi/c1-22(2,3)25(20-14-8-6-9-15-20,21-16-10-7-11-17-21)24-19-13-5-4-12-18-23/h4,6-12,14-17H,5,13,18-19H2,1-3H3 |
| InChIKey | WROHBEDBIWXBFE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.01 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|