C25H32O2Si — CID 11303939
(E,4S)-9-[tert-butyl(diphenyl)silyl]oxynon-5-en-1-yn-4-ol (PubChem CID 11303939) has the molecular formula C25H32O2Si and a molecular weight of 392.62 g/mol. Its IUPAC name is (E,4S)-9-[tert-butyl(diphenyl)silyl]oxynon-5-en-1-yn-4-ol.
| Compound Name | (E,4S)-9-[tert-butyl(diphenyl)silyl]oxynon-5-en-1-yn-4-ol |
|---|---|
| PubChem CID | 11303939 |
| Molecular Formula | C25H32O2Si |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (E,4S)-9-[tert-butyl(diphenyl)silyl]oxynon-5-en-1-yn-4-ol |
| SMILES | C#CC[C@H](O)/C=C/CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H32O2Si/c1-5-15-22(26)16-9-8-14-21-27-28(25(2,3)4,23-17-10-6-11-18-23)24-19-12-7-13-20-24/h1,6-7,9-13,16-20,22,26H,8,14-15,21H2,2-4H3/b16-9+/t22-/m0/s1 |
| InChIKey | MFQIFMKLDAQLJB-NAVGAYGYSA-N |
| XLogP | 4.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|