C36H50O5Si — CID 11828074
[(E,6S,7R,9R)-1-[tert-butyl(diphenyl)silyl]oxy-9-methyl-7-(oxan-2-yloxy)dodec-4-en-11-yn-6-yl] acetate (PubChem CID 11828074) has the molecular formula C36H50O5Si and a molecular weight of 590.88 g/mol. Its IUPAC name is [(E,6S,7R,9R)-1-[tert-butyl(diphenyl)silyl]oxy-9-methyl-7-(oxan-2-yloxy)dodec-4-en-11-yn-6-yl] acetate.
| Compound Name | [(E,6S,7R,9R)-1-[tert-butyl(diphenyl)silyl]oxy-9-methyl-7-(oxan-2-yloxy)dodec-4-en-11-yn-6-yl] acetate |
|---|---|
| PubChem CID | 11828074 |
| Molecular Formula | C36H50O5Si |
| Molecular Weight | 590.88 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | [(E,6S,7R,9R)-1-[tert-butyl(diphenyl)silyl]oxy-9-methyl-7-(oxan-2-yloxy)dodec-4-en-11-yn-6-yl] acetate |
| SMILES | C#CC[C@@H](C)C[C@@H](OC1CCCCO1)[C@H](/C=C/CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C36H50O5Si/c1-7-19-29(2)28-34(41-35-25-16-18-26-38-35)33(40-30(3)37)24-15-10-17-27-39-42(36(4,5)6,31-20-11-8-12-21-31)32-22-13-9-14-23-32/h1,8-9,11-15,20-24,29,33-35H,10,16-19,25-28H2,2-6H3/b24-15+/t29-,33+,34-,35?/m1/s1 |
| InChIKey | BXYKPLFFFWZEAH-BLIXNZOHSA-N |
| XLogP | 6.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.88 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|