C30H42O3Si — CID 166561282
tert-butyl-[[(1R,2S)-2-[(Z)-5-(oxan-2-yloxy)pent-2-enyl]cyclopropyl]methoxy]-diphenylsilane (PubChem CID 166561282) has the molecular formula C30H42O3Si and a molecular weight of 478.75 g/mol. Its IUPAC name is tert-butyl-[[(1R,2S)-2-[(Z)-5-(oxan-2-yloxy)pent-2-enyl]cyclopropyl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1R,2S)-2-[(Z)-5-(oxan-2-yloxy)pent-2-enyl]cyclopropyl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 166561282 |
| Molecular Formula | C30H42O3Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | tert-butyl-[[(1R,2S)-2-[(Z)-5-(oxan-2-yloxy)pent-2-enyl]cyclopropyl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@H]1C/C=C\CCOC1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H42O3Si/c1-30(2,3)34(27-16-8-4-9-17-27,28-18-10-5-11-19-28)33-24-26-23-25(26)15-7-6-13-21-31-29-20-12-14-22-32-29/h4-11,16-19,25-26,29H,12-15,20-24H2,1-3H3/b7-6-/t25-,26-,29?/m0/s1 |
| InChIKey | LZTQWXPLTRVECH-SUMRKYNFSA-N |
| XLogP | 6.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|