C40H68O6Si2 — CID 135836143
(2S,3R,4R,5R)-7-[tert-butyl(diphenyl)silyl]oxy-4-methyl-2-[2-(oxan-2-yloxy)ethyl]-5-tri(propan-2-yl)silyloxyheptane-1,3-diol (PubChem CID 135836143) has the molecular formula C40H68O6Si2 and a molecular weight of 701.15 g/mol. Its IUPAC name is (2S,3R,4R,5R)-7-[tert-butyl(diphenyl)silyl]oxy-4-methyl-2-[2-(oxan-2-yloxy)ethyl]-5-tri(propan-2-yl)silyloxyheptane-1,3-diol.
| Compound Name | (2S,3R,4R,5R)-7-[tert-butyl(diphenyl)silyl]oxy-4-methyl-2-[2-(oxan-2-yloxy)ethyl]-5-tri(propan-2-yl)silyloxyheptane-1,3-diol |
|---|---|
| PubChem CID | 135836143 |
| Molecular Formula | C40H68O6Si2 |
| Molecular Weight | 701.15 g/mol |
| Exact Mass | 700.46 |
| IUPAC Name | (2S,3R,4R,5R)-7-[tert-butyl(diphenyl)silyl]oxy-4-methyl-2-[2-(oxan-2-yloxy)ethyl]-5-tri(propan-2-yl)silyloxyheptane-1,3-diol |
| SMILES | CC(C)[Si](O[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)[C@H](O)[C@H](CO)CCOC1CCCCO1)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H68O6Si2/c1-30(2)47(31(3)4,32(5)6)46-37(33(7)39(42)34(29-41)24-27-44-38-23-17-18-26-43-38)25-28-45-48(40(8,9)10,35-19-13-11-14-20-35)36-21-15-12-16-22-36/h11-16,19-22,30-34,37-39,41-42H,17-18,23-29H2,1-10H3/t33-,34-,37+,38?,39-/m0/s1 |
| InChIKey | BHWHMUQLMMTPNG-BICXSAAGSA-N |
| XLogP | 8.05 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.15 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|