C28H40O3Si — CID 171813189
tert-butyl-[(2E)-2-[2-(oxan-2-yloxy)ethylidene]pentoxy]-diphenylsilane (PubChem CID 171813189) has the molecular formula C28H40O3Si and a molecular weight of 452.71 g/mol. Its IUPAC name is tert-butyl-[(2E)-2-[2-(oxan-2-yloxy)ethylidene]pentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2E)-2-[2-(oxan-2-yloxy)ethylidene]pentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 171813189 |
| Molecular Formula | C28H40O3Si |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | tert-butyl-[(2E)-2-[2-(oxan-2-yloxy)ethylidene]pentoxy]-diphenylsilane |
| SMILES | CCC/C(=C\COC1CCCCO1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H40O3Si/c1-5-14-24(20-22-30-27-19-12-13-21-29-27)23-31-32(28(2,3)4,25-15-8-6-9-16-25)26-17-10-7-11-18-26/h6-11,15-18,20,27H,5,12-14,19,21-23H2,1-4H3/b24-20+ |
| InChIKey | DIDYNBRFOFABCV-HIXSDJFHSA-N |
| XLogP | 5.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|