C28H42O4Si — CID 22244455
5-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethyl-3-(oxan-2-yloxy)pentan-1-ol (PubChem CID 22244455) has the molecular formula C28H42O4Si and a molecular weight of 470.73 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethyl-3-(oxan-2-yloxy)pentan-1-ol.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethyl-3-(oxan-2-yloxy)pentan-1-ol |
|---|---|
| PubChem CID | 22244455 |
| Molecular Formula | C28H42O4Si |
| Molecular Weight | 470.73 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethyl-3-(oxan-2-yloxy)pentan-1-ol |
| SMILES | CC(C)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(CCO)OC1CCCCO1 |
| InChI | InChI=1S/C28H42O4Si/c1-27(2,3)33(23-14-8-6-9-15-23,24-16-10-7-11-17-24)31-22-28(4,5)25(19-20-29)32-26-18-12-13-21-30-26/h6-11,14-17,25-26,29H,12-13,18-22H2,1-5H3 |
| InChIKey | WYRPBAJRUFNZLI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.73 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|