C28H40O4Si — CID 10972716
(2R,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-3-(oxan-2-yloxy)pent-4-en-1-ol (PubChem CID 10972716) has the molecular formula C28H40O4Si and a molecular weight of 468.71 g/mol. Its IUPAC name is (2R,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-3-(oxan-2-yloxy)pent-4-en-1-ol.
| Compound Name | (2R,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-3-(oxan-2-yloxy)pent-4-en-1-ol |
|---|---|
| PubChem CID | 10972716 |
| Molecular Formula | C28H40O4Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (2R,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-3-(oxan-2-yloxy)pent-4-en-1-ol |
| SMILES | C=C(C)[C@H](OC1CCCCO1)[C@H](CO)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H40O4Si/c1-22(2)27(32-26-18-12-13-19-30-26)23(20-29)21-31-33(28(3,4)5,24-14-8-6-9-15-24)25-16-10-7-11-17-25/h6-11,14-17,23,26-27,29H,1,12-13,18-21H2,2-5H3/t23-,26?,27+/m1/s1 |
| InChIKey | CJCDVDUANVFMHU-IDERCBEYSA-N |
| XLogP | 4.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|