C24H32O4Si — CID 10949681
[(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxepan-3-yl] formate (PubChem CID 10949681) has the molecular formula C24H32O4Si and a molecular weight of 412.60 g/mol. Its IUPAC name is [(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxepan-3-yl] formate.
| Compound Name | [(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxepan-3-yl] formate |
|---|---|
| PubChem CID | 10949681 |
| Molecular Formula | C24H32O4Si |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | [(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxepan-3-yl] formate |
| SMILES | CC(C)(C)[Si](OC[C@H]1OCCCC[C@@H]1OC=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32O4Si/c1-24(2,3)29(20-12-6-4-7-13-20,21-14-8-5-9-15-21)28-18-23-22(27-19-25)16-10-11-17-26-23/h4-9,12-15,19,22-23H,10-11,16-18H2,1-3H3/t22-,23+/m0/s1 |
| InChIKey | GDLRUNHILFWRJC-XZOQPEGZSA-N |
| XLogP | 3.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|