C36H45FO6Si — CID 19745383
2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(4-fluorophenyl)-2-(hydroxymethyl)-4-(oxan-2-yloxy)cyclopentyl]acetic acid (PubChem CID 19745383) has the molecular formula C36H45FO6Si and a molecular weight of 620.83 g/mol. Its IUPAC name is 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(4-fluorophenyl)-2-(hydroxymethyl)-4-(oxan-2-yloxy)cyclopentyl]acetic acid.
| Compound Name | 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(4-fluorophenyl)-2-(hydroxymethyl)-4-(oxan-2-yloxy)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 19745383 |
| Molecular Formula | C36H45FO6Si |
| Molecular Weight | 620.83 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(4-fluorophenyl)-2-(hydroxymethyl)-4-(oxan-2-yloxy)cyclopentyl]acetic acid |
| SMILES | CC(C)(C)[Si](OCC1C(OC2CCCCO2)CC(CO)(c2ccc(F)cc2)C1CC(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H45FO6Si/c1-35(2,3)44(28-12-6-4-7-13-28,29-14-8-5-9-15-29)42-24-30-31(22-33(39)40)36(25-38,26-17-19-27(37)20-18-26)23-32(30)43-34-16-10-11-21-41-34/h4-9,12-15,17-20,30-32,34,38H,10-11,16,21-25H2,1-3H3,(H,39,40) |
| InChIKey | XUEXDGWYLZXYAT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.83 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|