C35H50O5Si — CID 67858889
5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(oxan-2-yloxy)-7a-pentyl-1,4,4a,5,6,7-hexahydrocyclopenta[c]pyran-3-one (PubChem CID 67858889) has the molecular formula C35H50O5Si and a molecular weight of 578.87 g/mol. Its IUPAC name is 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(oxan-2-yloxy)-7a-pentyl-1,4,4a,5,6,7-hexahydrocyclopenta[c]pyran-3-one.
| Compound Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(oxan-2-yloxy)-7a-pentyl-1,4,4a,5,6,7-hexahydrocyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 67858889 |
| Molecular Formula | C35H50O5Si |
| Molecular Weight | 578.87 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(oxan-2-yloxy)-7a-pentyl-1,4,4a,5,6,7-hexahydrocyclopenta[c]pyran-3-one |
| SMILES | CCCCCC12COC(=O)CC1C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(OC1CCCCO1)C2 |
| InChI | InChI=1S/C35H50O5Si/c1-5-6-14-21-35-24-31(40-33-20-13-15-22-37-33)29(30(35)23-32(36)38-26-35)25-39-41(34(2,3)4,27-16-9-7-10-17-27)28-18-11-8-12-19-28/h7-12,16-19,29-31,33H,5-6,13-15,20-26H2,1-4H3 |
| InChIKey | DNXHIIXTPKIGBN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.87 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|