C21H38O4Si — CID 22821529
(4S,5R,6aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6a-methyl-5-(oxan-2-yloxy)-1,3,3a,4,5,6-hexahydropentalen-2-one (PubChem CID 22821529) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is (4S,5R,6aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6a-methyl-5-(oxan-2-yloxy)-1,3,3a,4,5,6-hexahydropentalen-2-one.
| Compound Name | (4S,5R,6aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6a-methyl-5-(oxan-2-yloxy)-1,3,3a,4,5,6-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 22821529 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (4S,5R,6aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6a-methyl-5-(oxan-2-yloxy)-1,3,3a,4,5,6-hexahydropentalen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C2CC(=O)C[C@@]2(C)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C21H38O4Si/c1-20(2,3)26(5,6)24-14-16-17-11-15(22)12-21(17,4)13-18(16)25-19-9-7-8-10-23-19/h16-19H,7-14H2,1-6H3/t16-,17?,18-,19?,21+/m1/s1 |
| InChIKey | LMZIFQGRPOTTMC-MXUKQXKSSA-N |
| XLogP | 4.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|