C22H40O6Si — CID 18632725
methyl 4-[(1S,2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]butanoate (PubChem CID 18632725) has the molecular formula C22H40O6Si and a molecular weight of 428.64 g/mol. Its IUPAC name is methyl 4-[(1S,2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]butanoate.
| Compound Name | methyl 4-[(1S,2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]butanoate |
|---|---|
| PubChem CID | 18632725 |
| Molecular Formula | C22H40O6Si |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | methyl 4-[(1S,2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]butanoate |
| SMILES | COC(=O)CCC[C@@H]1C(=O)C[C@H](OC2CCCCO2)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O6Si/c1-22(2,3)29(5,6)27-15-17-16(10-9-11-20(24)25-4)18(23)14-19(17)28-21-12-7-8-13-26-21/h16-17,19,21H,7-15H2,1-6H3/t16-,17-,19-,21?/m0/s1 |
| InChIKey | MCAHPAYAVUQQGB-FUSYNXAESA-N |
| XLogP | 4.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|