C26H44O6 — CID 70627792
methyl 7-[(1R,2R,3R)-2-(8-hydroxyoct-1-enyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate (PubChem CID 70627792) has the molecular formula C26H44O6 and a molecular weight of 452.63 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-2-(8-hydroxyoct-1-enyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-2-(8-hydroxyoct-1-enyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70627792 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-2-(8-hydroxyoct-1-enyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1C(=O)C[C@@H](OC2CCCCO2)[C@@H]1C=CCCCCCCO |
| InChI | InChI=1S/C26H44O6/c1-30-25(29)16-10-6-5-8-14-21-22(15-9-4-2-3-7-12-18-27)24(20-23(21)28)32-26-17-11-13-19-31-26/h9,15,21-22,24,26-27H,2-8,10-14,16-20H2,1H3/t21-,22-,24-,26?/m1/s1 |
| InChIKey | HDSAQAYBJBJRRX-LKJMEBJVSA-N |
| XLogP | 5.12 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|