C33H45ClO9 — CID 54328157
methyl 7-[(1R,2R,3R)-2-[(3R)-4-(3-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoate (PubChem CID 54328157) has the molecular formula C33H45ClO9 and a molecular weight of 621.17 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-2-[(3R)-4-(3-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-2-[(3R)-4-(3-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoate |
|---|---|
| PubChem CID | 54328157 |
| Molecular Formula | C33H45ClO9 |
| Molecular Weight | 621.17 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-2-[(3R)-4-(3-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoate |
| SMILES | COC(=O)CCCCC(=O)C[C@H]1C(=O)C[C@@H](OC2CCCCO2)[C@@H]1C=C[C@H](COc1cccc(Cl)c1)OC1CCCCO1 |
| InChI | InChI=1S/C33H45ClO9/c1-38-31(37)12-3-2-10-24(35)20-28-27(30(21-29(28)36)43-33-14-5-7-18-40-33)16-15-26(42-32-13-4-6-17-39-32)22-41-25-11-8-9-23(34)19-25/h8-9,11,15-16,19,26-28,30,32-33H,2-7,10,12-14,17-18,20-22H2,1H3/t26-,27-,28-,30-,32?,33?/m1/s1 |
| InChIKey | SWKUQOXJOKHEHS-DTFVSJLKSA-N |
| XLogP | 6.00 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.17 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|