C38H49ClO6Si — CID 10604440
(1S,2S,3R,4R)-3-[(E)-3-[tert-butyl(diphenyl)silyl]oxy-4-(3-chlorophenoxy)but-1-enyl]-2-(hydroxymethyl)-4-(oxan-2-yloxy)cyclohexan-1-ol (PubChem CID 10604440) has the molecular formula C38H49ClO6Si and a molecular weight of 665.34 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[(E)-3-[tert-butyl(diphenyl)silyl]oxy-4-(3-chlorophenoxy)but-1-enyl]-2-(hydroxymethyl)-4-(oxan-2-yloxy)cyclohexan-1-ol.
| Compound Name | (1S,2S,3R,4R)-3-[(E)-3-[tert-butyl(diphenyl)silyl]oxy-4-(3-chlorophenoxy)but-1-enyl]-2-(hydroxymethyl)-4-(oxan-2-yloxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 10604440 |
| Molecular Formula | C38H49ClO6Si |
| Molecular Weight | 665.34 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | (1S,2S,3R,4R)-3-[(E)-3-[tert-butyl(diphenyl)silyl]oxy-4-(3-chlorophenoxy)but-1-enyl]-2-(hydroxymethyl)-4-(oxan-2-yloxy)cyclohexan-1-ol |
| SMILES | CC(C)(C)[Si](OC(/C=C/[C@@H]1[C@@H](CO)[C@@H](O)CC[C@H]1OC1CCCCO1)COc1cccc(Cl)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H49ClO6Si/c1-38(2,3)46(31-15-6-4-7-16-31,32-17-8-5-9-18-32)45-30(27-43-29-14-12-13-28(39)25-29)20-21-33-34(26-40)35(41)22-23-36(33)44-37-19-10-11-24-42-37/h4-9,12-18,20-21,25,30,33-37,40-41H,10-11,19,22-24,26-27H2,1-3H3/b21-20+/t30?,33-,34-,35+,36-,37?/m1/s1 |
| InChIKey | VXPZHTRXPQFQHR-HERDNBOZSA-N |
| XLogP | 6.51 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.34 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|