C33H38ClNO4Si — CID 11203959
3-[(2R,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]oxolan-3-yl]propanenitrile (PubChem CID 11203959) has the molecular formula C33H38ClNO4Si and a molecular weight of 576.21 g/mol. Its IUPAC name is 3-[(2R,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]oxolan-3-yl]propanenitrile.
| Compound Name | 3-[(2R,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]oxolan-3-yl]propanenitrile |
|---|---|
| PubChem CID | 11203959 |
| Molecular Formula | C33H38ClNO4Si |
| Molecular Weight | 576.21 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 3-[(2R,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]oxolan-3-yl]propanenitrile |
| SMILES | CC(C)(C)[Si](O[C@H]1CO[C@H](/C=C/[C@@H](O)COc2cccc(Cl)c2)[C@H]1CCC#N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H38ClNO4Si/c1-33(2,3)40(28-14-6-4-7-15-28,29-16-8-5-9-17-29)39-32-24-38-31(30(32)18-11-21-35)20-19-26(36)23-37-27-13-10-12-25(34)22-27/h4-10,12-17,19-20,22,26,30-32,36H,11,18,23-24H2,1-3H3/b20-19+/t26-,30-,31-,32+/m1/s1 |
| InChIKey | ZQLHBKJNRCURMB-WJTAJUILSA-N |
| XLogP | 5.90 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.21 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|