C22H32O4 — CID 18718299
4-[(E)-hept-2-enyl]-5-[(E)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]oxolan-3-ol (PubChem CID 18718299) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is 4-[(E)-hept-2-enyl]-5-[(E)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]oxolan-3-ol.
| Compound Name | 4-[(E)-hept-2-enyl]-5-[(E)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]oxolan-3-ol |
|---|---|
| PubChem CID | 18718299 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 4-[(E)-hept-2-enyl]-5-[(E)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]oxolan-3-ol |
| SMILES | CCCC/C=C/CC1C(O)COC1/C=C/C(O)COc1cccc(C)c1 |
| InChI | InChI=1S/C22H32O4/c1-3-4-5-6-7-11-20-21(24)16-26-22(20)13-12-18(23)15-25-19-10-8-9-17(2)14-19/h6-10,12-14,18,20-24H,3-5,11,15-16H2,1-2H3/b7-6+,13-12+ |
| InChIKey | OMWWBTAFSWFZBF-GYIPPJPDSA-N |
| XLogP | 3.80 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|