C23H32O5 — CID 58218958
(E)-7-[(1R,2S)-2-hydroxy-5-[(E,3R)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 58218958) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is (E)-7-[(1R,2S)-2-hydroxy-5-[(E,3R)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[(1R,2S)-2-hydroxy-5-[(E,3R)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 58218958 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (E)-7-[(1R,2S)-2-hydroxy-5-[(E,3R)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | Cc1cccc(OC[C@H](O)/C=C/C2CC[C@H](O)[C@@H]2C/C=C/CCCC(=O)O)c1 |
| InChI | InChI=1S/C23H32O5/c1-17-7-6-8-20(15-17)28-16-19(24)13-11-18-12-14-22(25)21(18)9-4-2-3-5-10-23(26)27/h2,4,6-8,11,13,15,18-19,21-22,24-25H,3,5,9-10,12,14,16H2,1H3,(H,26,27)/b4-2+,13-11+/t18?,19-,21-,22+/m1/s1 |
| InChIKey | YDTXHKAYILZRKR-ZJDSTPLGSA-N |
| XLogP | 3.88 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|