C22H27FO6 — CID 70549987
(Z)-7-[(1R,2R,5S)-2-[(E,3R)-4-(3-fluorophenoxy)-3-hydroxybut-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70549987) has the molecular formula C22H27FO6 and a molecular weight of 406.45 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-2-[(E,3R)-4-(3-fluorophenoxy)-3-hydroxybut-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-2-[(E,3R)-4-(3-fluorophenoxy)-3-hydroxybut-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70549987 |
| Molecular Formula | C22H27FO6 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-2-[(E,3R)-4-(3-fluorophenoxy)-3-hydroxybut-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@@H](O)CC(=O)[C@@H]1/C=C/[C@@H](O)COc1cccc(F)c1 |
| InChI | InChI=1S/C22H27FO6/c23-15-6-5-7-17(12-15)29-14-16(24)10-11-19-18(20(25)13-21(19)26)8-3-1-2-4-9-22(27)28/h1,3,5-7,10-12,16,18-20,24-25H,2,4,8-9,13-14H2,(H,27,28)/b3-1-,11-10+/t16-,18-,19-,20+/m1/s1 |
| InChIKey | QUVMJDGXVDIGAZ-KYUUVOLFSA-N |
| XLogP | 2.89 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|