C25H33NO5 — CID 146900881
N-cyclopropyl-7-[(1R,2R,5S)-5-hydroxy-2-[(3R)-3-hydroxy-4-phenoxybut-1-enyl]-3-oxocyclopentyl]hept-5-enamide (PubChem CID 146900881) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is N-cyclopropyl-7-[(1R,2R,5S)-5-hydroxy-2-[(3R)-3-hydroxy-4-phenoxybut-1-enyl]-3-oxocyclopentyl]hept-5-enamide.
| Compound Name | N-cyclopropyl-7-[(1R,2R,5S)-5-hydroxy-2-[(3R)-3-hydroxy-4-phenoxybut-1-enyl]-3-oxocyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 146900881 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | N-cyclopropyl-7-[(1R,2R,5S)-5-hydroxy-2-[(3R)-3-hydroxy-4-phenoxybut-1-enyl]-3-oxocyclopentyl]hept-5-enamide |
| SMILES | O=C(CCCC=CC[C@H]1[C@@H](O)CC(=O)[C@@H]1C=C[C@@H](O)COc1ccccc1)NC1CC1 |
| InChI | InChI=1S/C25H33NO5/c27-19(17-31-20-8-4-3-5-9-20)14-15-22-21(23(28)16-24(22)29)10-6-1-2-7-11-25(30)26-18-12-13-18/h1,3-6,8-9,14-15,18-19,21-23,27-28H,2,7,10-13,16-17H2,(H,26,30)/t19-,21-,22-,23+/m1/s1 |
| InChIKey | KSYMTLMTXUSPQS-ADHNFCLRSA-N |
| XLogP | 2.94 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|