C25H31NO4 — CID 146900868
N-cyclopropyl-7-[2-[(3R)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enamide (PubChem CID 146900868) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-cyclopropyl-7-[2-[(3R)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enamide.
| Compound Name | N-cyclopropyl-7-[2-[(3R)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enamide |
|---|---|
| PubChem CID | 146900868 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-cyclopropyl-7-[2-[(3R)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enamide |
| SMILES | O=C(CCCC=CCC1=C(C=C[C@@H](O)COc2ccccc2)CCC1=O)NC1CC1 |
| InChI | InChI=1S/C25H31NO4/c27-21(18-30-22-8-4-3-5-9-22)16-12-19-13-17-24(28)23(19)10-6-1-2-7-11-25(29)26-20-14-15-20/h1,3-6,8-9,12,16,20-21,27H,2,7,10-11,13-15,17-18H2,(H,26,29)/t21-/m1/s1 |
| InChIKey | SBBRZDQSVGZODO-OAQYLSRUSA-N |
| XLogP | 4.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|