C22H28O5 — CID 10809298
(Z)-7-[(4S,5R)-4-hydroxy-5-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]cyclopenten-1-yl]hept-5-enoic acid (PubChem CID 10809298) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (Z)-7-[(4S,5R)-4-hydroxy-5-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]cyclopenten-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(4S,5R)-4-hydroxy-5-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]cyclopenten-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10809298 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (Z)-7-[(4S,5R)-4-hydroxy-5-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]cyclopenten-1-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\CC1=CC[C@H](O)[C@@H]1/C=C/[C@@H](O)COc1ccccc1 |
| InChI | InChI=1S/C22H28O5/c23-18(16-27-19-9-5-3-6-10-19)13-14-20-17(12-15-21(20)24)8-4-1-2-7-11-22(25)26/h1,3-6,9-10,12-14,18,20-21,23-24H,2,7-8,11,15-16H2,(H,25,26)/b4-1-,14-13+/t18-,20-,21+/m1/s1 |
| InChIKey | JNSHSGKZWKTRBV-KHFLGSKTSA-N |
| XLogP | 3.49 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|