C26H33NO3 — CID 146900873
N-cyclopropyl-7-[(1R)-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopent-2-en-1-yl]hept-5-enamide (PubChem CID 146900873) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is N-cyclopropyl-7-[(1R)-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopent-2-en-1-yl]hept-5-enamide.
| Compound Name | N-cyclopropyl-7-[(1R)-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopent-2-en-1-yl]hept-5-enamide |
|---|---|
| PubChem CID | 146900873 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | N-cyclopropyl-7-[(1R)-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopent-2-en-1-yl]hept-5-enamide |
| SMILES | O=C(CCCC=CC[C@H]1C(=O)CC=C1C=C[C@@H](O)CCc1ccccc1)NC1CC1 |
| InChI | InChI=1S/C26H33NO3/c28-23(17-12-20-8-4-3-5-9-20)18-13-21-14-19-25(29)24(21)10-6-1-2-7-11-26(30)27-22-15-16-22/h1,3-6,8-9,13-14,18,22-24,28H,2,7,10-12,15-17,19H2,(H,27,30)/t23-,24+/m0/s1 |
| InChIKey | URNLFSYWLUJLGT-BJKOFHAPSA-N |
| XLogP | 4.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|