C22H28O4 — CID 70389922
(Z)-7-[(1R)-2-(3-hydroxy-4-phenylbutyl)-5-oxocyclopent-2-en-1-yl]hept-5-enoic acid (PubChem CID 70389922) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (Z)-7-[(1R)-2-(3-hydroxy-4-phenylbutyl)-5-oxocyclopent-2-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R)-2-(3-hydroxy-4-phenylbutyl)-5-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70389922 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (Z)-7-[(1R)-2-(3-hydroxy-4-phenylbutyl)-5-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1C(=O)CC=C1CCC(O)Cc1ccccc1 |
| InChI | InChI=1S/C22H28O4/c23-19(16-17-8-4-3-5-9-17)14-12-18-13-15-21(24)20(18)10-6-1-2-7-11-22(25)26/h1,3-6,8-9,13,19-20,23H,2,7,10-12,14-16H2,(H,25,26)/b6-1-/t19?,20-/m1/s1 |
| InChIKey | DIQCEHKMWVUQQZ-XNIDZOCISA-N |
| XLogP | 4.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|