C28H42O5Si — CID 70390089
(Z)-7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]-5-oxocyclopent-2-en-1-yl]hept-5-enoic acid (PubChem CID 70390089) has the molecular formula C28H42O5Si and a molecular weight of 486.73 g/mol. Its IUPAC name is (Z)-7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]-5-oxocyclopent-2-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]-5-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70390089 |
| Molecular Formula | C28H42O5Si |
| Molecular Weight | 486.73 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | (Z)-7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]-5-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCC1=CCC(=O)[C@@H]1C/C=C\CCCC(=O)O)COc1ccccc1 |
| InChI | InChI=1S/C28H42O5Si/c1-28(2,3)34(4,5)33-24(21-32-23-13-9-8-10-14-23)19-17-22-18-20-26(29)25(22)15-11-6-7-12-16-27(30)31/h6,8-11,13-14,18,24-25H,7,12,15-17,19-21H2,1-5H3,(H,30,31)/b11-6-/t24?,25-/m1/s1 |
| InChIKey | RTPRLAXPHOYRIS-ZLVYKWOQSA-N |
| XLogP | 6.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.73 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|