C28H46O5Si — CID 18636967
7-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]-5-hydroxycyclopent-2-en-1-yl]heptanoic acid (PubChem CID 18636967) has the molecular formula C28H46O5Si and a molecular weight of 490.76 g/mol. Its IUPAC name is 7-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]-5-hydroxycyclopent-2-en-1-yl]heptanoic acid.
| Compound Name | 7-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]-5-hydroxycyclopent-2-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 18636967 |
| Molecular Formula | C28H46O5Si |
| Molecular Weight | 490.76 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 7-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]-5-hydroxycyclopent-2-en-1-yl]heptanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CCC1=CC[C@H](O)[C@@H]1CCCCCCC(=O)O)COc1ccccc1 |
| InChI | InChI=1S/C28H46O5Si/c1-28(2,3)34(4,5)33-24(21-32-23-13-9-8-10-14-23)19-17-22-18-20-26(29)25(22)15-11-6-7-12-16-27(30)31/h8-10,13-14,18,24-26,29H,6-7,11-12,15-17,19-21H2,1-5H3,(H,30,31)/t24-,25+,26-/m0/s1 |
| InChIKey | SVTQRGASQKOOED-NXCFDTQHSA-N |
| XLogP | 6.97 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.76 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|