C23H36O4Si — CID 19836141
2-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid (PubChem CID 19836141) has the molecular formula C23H36O4Si and a molecular weight of 404.62 g/mol. Its IUPAC name is 2-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 19836141 |
| Molecular Formula | C23H36O4Si |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 2-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCC1=CCC(O)C1CC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C23H36O4Si/c1-23(2,3)28(4,5)27-19(15-17-9-7-6-8-10-17)13-11-18-12-14-21(24)20(18)16-22(25)26/h6-10,12,19-21,24H,11,13-16H2,1-5H3,(H,25,26) |
| InChIKey | YLKRZDBLKDUTBT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|