C26H46O4Si — CID 18636971
7-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 18636971) has the molecular formula C26H46O4Si and a molecular weight of 450.74 g/mol. Its IUPAC name is 7-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 7-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 18636971 |
| Molecular Formula | C26H46O4Si |
| Molecular Weight | 450.74 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 7-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CCCCC[C@@H](CCC1=CC[C@H](O)[C@@H]1CCC=C=CCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O4Si/c1-7-8-11-14-22(30-31(5,6)26(2,3)4)19-17-21-18-20-24(27)23(21)15-12-9-10-13-16-25(28)29/h9,13,18,22-24,27H,7-8,11-12,14-17,19-20H2,1-6H3,(H,28,29)/t10?,22-,23+,24-/m0/s1 |
| InChIKey | ZWHZKYWDIIYRHE-CZUBGPHQSA-N |
| XLogP | 7.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.74 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|