C33H56O5Si — CID 67758851
(E)-7-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxyoctyl]-3-hydroxy-5-phenylmethoxycyclopentyl]hept-3-enoic acid (PubChem CID 67758851) has the molecular formula C33H56O5Si and a molecular weight of 560.89 g/mol. Its IUPAC name is (E)-7-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxyoctyl]-3-hydroxy-5-phenylmethoxycyclopentyl]hept-3-enoic acid.
| Compound Name | (E)-7-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxyoctyl]-3-hydroxy-5-phenylmethoxycyclopentyl]hept-3-enoic acid |
|---|---|
| PubChem CID | 67758851 |
| Molecular Formula | C33H56O5Si |
| Molecular Weight | 560.89 g/mol |
| Exact Mass | 560.39 |
| IUPAC Name | (E)-7-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxyoctyl]-3-hydroxy-5-phenylmethoxycyclopentyl]hept-3-enoic acid |
| SMILES | CCCCCC(CC[C@@H]1[C@@H](CCC/C=C/CC(=O)O)[C@@H](OCc2ccccc2)C[C@H]1O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H56O5Si/c1-7-8-12-19-27(38-39(5,6)33(2,3)4)22-23-28-29(20-15-9-10-16-21-32(35)36)31(24-30(28)34)37-25-26-17-13-11-14-18-26/h10-11,13-14,16-18,27-31,34H,7-9,12,15,19-25H2,1-6H3,(H,35,36)/b16-10+/t27?,28-,29-,30-,31+/m1/s1 |
| InChIKey | ICDUWDXIZLWEFS-PIHOZITASA-N |
| XLogP | 8.52 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.89 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|