C34H44F2O5 — CID 66690502
2-benzyl-7-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-5-hydroxy-3-phenylmethoxycyclopentyl]hept-5-enoic acid (PubChem CID 66690502) has the molecular formula C34H44F2O5 and a molecular weight of 570.72 g/mol. Its IUPAC name is 2-benzyl-7-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-5-hydroxy-3-phenylmethoxycyclopentyl]hept-5-enoic acid.
| Compound Name | 2-benzyl-7-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-5-hydroxy-3-phenylmethoxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 66690502 |
| Molecular Formula | C34H44F2O5 |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | 2-benzyl-7-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-5-hydroxy-3-phenylmethoxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(F)(F)C(=O)CC[C@@H]1[C@@H](CC=CCCC(Cc2ccccc2)C(=O)O)[C@@H](O)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H44F2O5/c1-2-3-21-34(35,36)32(38)20-19-29-28(30(37)23-31(29)41-24-26-15-9-5-10-16-26)18-12-6-11-17-27(33(39)40)22-25-13-7-4-8-14-25/h4-10,12-16,27-31,37H,2-3,11,17-24H2,1H3,(H,39,40)/t27?,28-,29-,30+,31-/m1/s1 |
| InChIKey | XYPBQBMMLCVGMF-ZRVLFQQHSA-N |
| XLogP | 7.41 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|