C20H31F2O5P — CID 59963482
(Z)-7-[(2R)-2-(4,4-difluoro-3-oxooctyl)-5-oxo-3-phosphanyloxycyclopentyl]hept-5-enoic acid (PubChem CID 59963482) has the molecular formula C20H31F2O5P and a molecular weight of 420.43 g/mol. Its IUPAC name is (Z)-7-[(2R)-2-(4,4-difluoro-3-oxooctyl)-5-oxo-3-phosphanyloxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2R)-2-(4,4-difluoro-3-oxooctyl)-5-oxo-3-phosphanyloxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 59963482 |
| Molecular Formula | C20H31F2O5P |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (Z)-7-[(2R)-2-(4,4-difluoro-3-oxooctyl)-5-oxo-3-phosphanyloxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(F)(F)C(=O)CC[C@H]1C(OP)CC(=O)C1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H31F2O5P/c1-2-3-12-20(21,22)18(24)11-10-15-14(16(23)13-17(15)27-28)8-6-4-5-7-9-19(25)26/h4,6,14-15,17H,2-3,5,7-13,28H2,1H3,(H,25,26)/b6-4-/t14?,15-,17?/m1/s1 |
| InChIKey | BFYKZRVTBWUMJF-YKTXNJKDSA-N |
| XLogP | 4.74 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|