C32H44F2O5 — CID 124643393
(2R,3R,4R)-3-(4,4-difluoro-3-oxooctyl)-4-[(2S)-oxan-2-yl]oxy-2-[(E)-7-oxo-8-phenyloct-2-enyl]cyclopentan-1-one (PubChem CID 124643393) has the molecular formula C32H44F2O5 and a molecular weight of 546.70 g/mol. Its IUPAC name is (2R,3R,4R)-3-(4,4-difluoro-3-oxooctyl)-4-[(2S)-oxan-2-yl]oxy-2-[(E)-7-oxo-8-phenyloct-2-enyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-3-(4,4-difluoro-3-oxooctyl)-4-[(2S)-oxan-2-yl]oxy-2-[(E)-7-oxo-8-phenyloct-2-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 124643393 |
| Molecular Formula | C32H44F2O5 |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | (2R,3R,4R)-3-(4,4-difluoro-3-oxooctyl)-4-[(2S)-oxan-2-yl]oxy-2-[(E)-7-oxo-8-phenyloct-2-enyl]cyclopentan-1-one |
| SMILES | CCCCC(F)(F)C(=O)CC[C@H]1[C@H](O[C@H]2CCCCO2)CC(=O)[C@@H]1C/C=C/CCCC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C32H44F2O5/c1-2-3-20-32(33,34)30(37)19-18-27-26(28(36)23-29(27)39-31-17-11-12-21-38-31)16-10-5-4-9-15-25(35)22-24-13-7-6-8-14-24/h5-8,10,13-14,26-27,29,31H,2-4,9,11-12,15-23H2,1H3/b10-5+/t26-,27-,29-,31+/m1/s1 |
| InChIKey | FAMKBNMJZADCID-BKXONWTISA-N |
| XLogP | 7.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|