C34H52F2O6 — CID 139602821
benzyl (Z)-9-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-hydroxyoctyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]non-7-enoate (PubChem CID 139602821) has the molecular formula C34H52F2O6 and a molecular weight of 594.78 g/mol. Its IUPAC name is benzyl (Z)-9-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-hydroxyoctyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]non-7-enoate.
| Compound Name | benzyl (Z)-9-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-hydroxyoctyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]non-7-enoate |
|---|---|
| PubChem CID | 139602821 |
| Molecular Formula | C34H52F2O6 |
| Molecular Weight | 594.78 g/mol |
| Exact Mass | 594.37 |
| IUPAC Name | benzyl (Z)-9-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-hydroxyoctyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]non-7-enoate |
| SMILES | CCCCC(F)(F)C(O)CC[C@@H]1[C@@H](C/C=C\CCCCCC(=O)OCc2ccccc2)[C@@H](O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C34H52F2O6/c1-2-3-22-34(35,36)31(38)21-20-28-27(29(37)24-30(28)42-33-19-13-14-23-40-33)17-11-6-4-5-7-12-18-32(39)41-25-26-15-9-8-10-16-26/h6,8-11,15-16,27-31,33,37-38H,2-5,7,12-14,17-25H2,1H3/b11-6-/t27-,28-,29+,30-,31?,33?/m1/s1 |
| InChIKey | PBBVXVAMDAUKHJ-FDAGWBRHSA-N |
| XLogP | 7.50 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.78 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|