C28H42F2O4 — CID 122493459
benzyl 7-[(1R,2S,3R)-2-(4,4-difluoro-3-hydroxyoctyl)-3-methyl-5-oxocyclopentyl]heptanoate (PubChem CID 122493459) has the molecular formula C28H42F2O4 and a molecular weight of 480.64 g/mol. Its IUPAC name is benzyl 7-[(1R,2S,3R)-2-(4,4-difluoro-3-hydroxyoctyl)-3-methyl-5-oxocyclopentyl]heptanoate.
| Compound Name | benzyl 7-[(1R,2S,3R)-2-(4,4-difluoro-3-hydroxyoctyl)-3-methyl-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 122493459 |
| Molecular Formula | C28H42F2O4 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | benzyl 7-[(1R,2S,3R)-2-(4,4-difluoro-3-hydroxyoctyl)-3-methyl-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCC(F)(F)C(O)CC[C@H]1[C@H](C)CC(=O)[C@@H]1CCCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H42F2O4/c1-3-4-18-28(29,30)26(32)17-16-23-21(2)19-25(31)24(23)14-10-5-6-11-15-27(33)34-20-22-12-8-7-9-13-22/h7-9,12-13,21,23-24,26,32H,3-6,10-11,14-20H2,1-2H3/t21-,23+,24-,26?/m1/s1 |
| InChIKey | ZIQPKGUKMPFONV-QVJPAZNPSA-N |
| XLogP | 6.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|