C26H46F2O4 — CID 22796891
hexyl 7-[(1R,2S)-2-[(3S)-4,4-difluoro-3-hydroxyoctyl]-5-oxocyclopentyl]heptanoate (PubChem CID 22796891) has the molecular formula C26H46F2O4 and a molecular weight of 460.65 g/mol. Its IUPAC name is hexyl 7-[(1R,2S)-2-[(3S)-4,4-difluoro-3-hydroxyoctyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | hexyl 7-[(1R,2S)-2-[(3S)-4,4-difluoro-3-hydroxyoctyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22796891 |
| Molecular Formula | C26H46F2O4 |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | hexyl 7-[(1R,2S)-2-[(3S)-4,4-difluoro-3-hydroxyoctyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCCOC(=O)CCCCCC[C@H]1C(=O)CC[C@@H]1CC[C@H](O)C(F)(F)CCCC |
| InChI | InChI=1S/C26H46F2O4/c1-3-5-7-12-20-32-25(31)14-11-9-8-10-13-22-21(15-17-23(22)29)16-18-24(30)26(27,28)19-6-4-2/h21-22,24,30H,3-20H2,1-2H3/t21-,22-,24+/m1/s1 |
| InChIKey | MMFFSHNXTRZSPG-AKFKNWHVSA-N |
| XLogP | 7.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|