C19H35NO3 — CID 18594831
6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid (PubChem CID 18594831) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid.
| Compound Name | 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid |
|---|---|
| PubChem CID | 18594831 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid |
| SMILES | CCCCCC(N)CC[C@H]1CCC(=O)[C@@H]1CCCCCC(=O)O |
| InChI | InChI=1S/C19H35NO3/c1-2-3-5-8-16(20)13-11-15-12-14-18(21)17(15)9-6-4-7-10-19(22)23/h15-17H,2-14,20H2,1H3,(H,22,23)/t15-,16?,17+/m0/s1 |
| InChIKey | YLESHQKYJMKHLW-RPCGPGEBSA-N |
| XLogP | 4.30 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|