6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid

C19H35NO3 — CID 18594831

IUPAC6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid
SMILESCCCCCC(N)CC[C@H]1CCC(=O)[C@@H]1CCCCCC(=O)O
InChIInChI=1S/C19H35NO3/c1-2-3-5-8-16(20)13-11-15-12-14-18(21)17(15)9-6-4-7-10-19(22)23/h15-17H,2-14,20H2,1H3,(H,22,23)/t15-,16?,17+/m0/s1
InChIKeyYLESHQKYJMKHLW-RPCGPGEBSA-N
MW325.49 g/mol
LogP4.30
Rot. Bonds13

About 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid

6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid (PubChem CID 18594831) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid.

Molecular Properties

Compound Name6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid
PubChem CID18594831
Molecular FormulaC19H35NO3
Molecular Weight325.49 g/mol
Exact Mass325.26
IUPAC Name6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid
SMILESCCCCCC(N)CC[C@H]1CCC(=O)[C@@H]1CCCCCC(=O)O
InChIInChI=1S/C19H35NO3/c1-2-3-5-8-16(20)13-11-15-12-14-18(21)17(15)9-6-4-7-10-19(22)23/h15-17H,2-14,20H2,1H3,(H,22,23)/t15-,16?,17+/m0/s1
InChIKeyYLESHQKYJMKHLW-RPCGPGEBSA-N
XLogP4.30
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds13
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.49
LogP ≤ 54.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid?
The IUPAC name of 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid (CID 18594831) is 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid.
What is the SMILES notation for 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid?
The canonical SMILES for 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid is CCCCCC(N)CC[C@H]1CCC(=O)[C@@H]1CCCCCC(=O)O.
What is the InChIKey of 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid?
The InChIKey is YLESHQKYJMKHLW-RPCGPGEBSA-N. The full InChI is InChI=1S/C19H35NO3/c1-2-3-5-8-16(20)13-11-15-12-14-18(21)17(15)9-6-4-7-10-19(22)23/h15-17H,2-14,20H2,1H3,(H,22,23)/t15-,16?,17+/m0/s1.
What are the key properties of 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid?
6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid has a molecular weight of 325.49 g/mol, XLogP of 4.30, 13 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1R,2S)-2-(3-aminooctyl)-5-oxocyclopentyl]hexanoic acid is sourced from PubChem (CID 18594831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).