C21H34F2O4 — CID 154008029
7-[(2R)-2-(4,4-difluoro-3-oxononyl)-5-oxocyclopentyl]heptanoic acid (PubChem CID 154008029) has the molecular formula C21H34F2O4 and a molecular weight of 388.50 g/mol. Its IUPAC name is 7-[(2R)-2-(4,4-difluoro-3-oxononyl)-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(2R)-2-(4,4-difluoro-3-oxononyl)-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 154008029 |
| Molecular Formula | C21H34F2O4 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 7-[(2R)-2-(4,4-difluoro-3-oxononyl)-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCCC(F)(F)C(=O)CC[C@H]1CCC(=O)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C21H34F2O4/c1-2-3-8-15-21(22,23)19(25)14-12-16-11-13-18(24)17(16)9-6-4-5-7-10-20(26)27/h16-17H,2-15H2,1H3,(H,26,27)/t16-,17?/m1/s1 |
| InChIKey | SVIKAFWKCKRCLC-TZHYSIJRSA-N |
| XLogP | 5.57 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|